About 1-cyclohex-3-en-1-yl-N,2,3-trimethylpiperidin-4-amine
1-cyclohex-3-en-1-yl-N,2,3-trimethylpiperidin-4-amine (PubChem CID 79406492) has the molecular formula C14H26N2
and a molecular weight of 222.38 g/mol. Its IUPAC name is 1-cyclohex-3-en-1-yl-N,2,3-trimethylpiperidin-4-amine.
Molecular Properties
| Compound Name | 1-cyclohex-3-en-1-yl-N,2,3-trimethylpiperidin-4-amine |
| PubChem CID | 79406492 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | 1-cyclohex-3-en-1-yl-N,2,3-trimethylpiperidin-4-amine |
| SMILES | CNC1CCN(C2CC=CCC2)C(C)C1C |
| InChI | InChI=1S/C14H26N2/c1-11-12(2)16(10-9-14(11)15-3)13-7-5-4-6-8-13/h4-5,11-15H,6-10H2,1-3H3 |
| InChIKey | KEFPRMVQONUTDQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohex-3-en-1-yl-N,2,3-trimethylpiperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohex-3-en-1-yl-N,2,3-trimethylpiperidin-4-amine?
The IUPAC name of 1-cyclohex-3-en-1-yl-N,2,3-trimethylpiperidin-4-amine (CID 79406492) is 1-cyclohex-3-en-1-yl-N,2,3-trimethylpiperidin-4-amine.
What is the SMILES notation for 1-cyclohex-3-en-1-yl-N,2,3-trimethylpiperidin-4-amine?
The canonical SMILES for 1-cyclohex-3-en-1-yl-N,2,3-trimethylpiperidin-4-amine is CNC1CCN(C2CC=CCC2)C(C)C1C.
What is the InChIKey of 1-cyclohex-3-en-1-yl-N,2,3-trimethylpiperidin-4-amine?
The InChIKey is KEFPRMVQONUTDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2/c1-11-12(2)16(10-9-14(11)15-3)13-7-5-4-6-8-13/h4-5,11-15H,6-10H2,1-3H3.
What are the key properties of 1-cyclohex-3-en-1-yl-N,2,3-trimethylpiperidin-4-amine?
1-cyclohex-3-en-1-yl-N,2,3-trimethylpiperidin-4-amine has a molecular weight of 222.38 g/mol, XLogP of 2.41, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohex-3-en-1-yl-N,2,3-trimethylpiperidin-4-amine is sourced from PubChem (CID 79406492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).