C11H24N2O — CID 79409026
3-(2,5-dimethylmorpholin-4-yl)-2-methylbutan-1-amine (PubChem CID 79409026) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is 3-(2,5-dimethylmorpholin-4-yl)-2-methylbutan-1-amine.
| Compound Name | 3-(2,5-dimethylmorpholin-4-yl)-2-methylbutan-1-amine |
|---|---|
| PubChem CID | 79409026 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | 3-(2,5-dimethylmorpholin-4-yl)-2-methylbutan-1-amine |
| SMILES | CC1CN(C(C)C(C)CN)C(C)CO1 |
| InChI | InChI=1S/C11H24N2O/c1-8(5-12)11(4)13-6-10(3)14-7-9(13)2/h8-11H,5-7,12H2,1-4H3 |
| InChIKey | ZFYLATGATSYRCJ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |