About 3-(3-ethyl-4-methylpiperazin-1-yl)-N,2-dimethylbutan-1-amine
3-(3-ethyl-4-methylpiperazin-1-yl)-N,2-dimethylbutan-1-amine (PubChem CID 79409074) has the molecular formula C13H29N3
and a molecular weight of 227.40 g/mol. Its IUPAC name is 3-(3-ethyl-4-methylpiperazin-1-yl)-N,2-dimethylbutan-1-amine.
Molecular Properties
| Compound Name | 3-(3-ethyl-4-methylpiperazin-1-yl)-N,2-dimethylbutan-1-amine |
| PubChem CID | 79409074 |
| Molecular Formula | C13H29N3 |
| Molecular Weight | 227.40 g/mol |
| Exact Mass | 227.24 |
| IUPAC Name | 3-(3-ethyl-4-methylpiperazin-1-yl)-N,2-dimethylbutan-1-amine |
| SMILES | CCC1CN(C(C)C(C)CNC)CCN1C |
| InChI | InChI=1S/C13H29N3/c1-6-13-10-16(8-7-15(13)5)12(3)11(2)9-14-4/h11-14H,6-10H2,1-5H3 |
| InChIKey | UOZBBRJMCFQIBV-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.40 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3-ethyl-4-methylpiperazin-1-yl)-N,2-dimethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-ethyl-4-methylpiperazin-1-yl)-N,2-dimethylbutan-1-amine?
The IUPAC name of 3-(3-ethyl-4-methylpiperazin-1-yl)-N,2-dimethylbutan-1-amine (CID 79409074) is 3-(3-ethyl-4-methylpiperazin-1-yl)-N,2-dimethylbutan-1-amine.
What is the SMILES notation for 3-(3-ethyl-4-methylpiperazin-1-yl)-N,2-dimethylbutan-1-amine?
The canonical SMILES for 3-(3-ethyl-4-methylpiperazin-1-yl)-N,2-dimethylbutan-1-amine is CCC1CN(C(C)C(C)CNC)CCN1C.
What is the InChIKey of 3-(3-ethyl-4-methylpiperazin-1-yl)-N,2-dimethylbutan-1-amine?
The InChIKey is UOZBBRJMCFQIBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29N3/c1-6-13-10-16(8-7-15(13)5)12(3)11(2)9-14-4/h11-14H,6-10H2,1-5H3.
What are the key properties of 3-(3-ethyl-4-methylpiperazin-1-yl)-N,2-dimethylbutan-1-amine?
3-(3-ethyl-4-methylpiperazin-1-yl)-N,2-dimethylbutan-1-amine has a molecular weight of 227.40 g/mol, XLogP of 1.26, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-ethyl-4-methylpiperazin-1-yl)-N,2-dimethylbutan-1-amine is sourced from PubChem (CID 79409074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).