About 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methyl-N-propan-2-ylbutan-1-amine
3-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methyl-N-propan-2-ylbutan-1-amine (PubChem CID 79409091) has the molecular formula C13H24BrN3
and a molecular weight of 302.26 g/mol. Its IUPAC name is 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methyl-N-propan-2-ylbutan-1-amine.
Molecular Properties
| Compound Name | 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methyl-N-propan-2-ylbutan-1-amine |
| PubChem CID | 79409091 |
| Molecular Formula | C13H24BrN3 |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methyl-N-propan-2-ylbutan-1-amine |
| SMILES | Cc1nn(C(C)C(C)CNC(C)C)c(C)c1Br |
| InChI | InChI=1S/C13H24BrN3/c1-8(2)15-7-9(3)11(5)17-12(6)13(14)10(4)16-17/h8-9,11,15H,7H2,1-6H3 |
| InChIKey | LWJNWSGJMXWPPG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methyl-N-propan-2-ylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methyl-N-propan-2-ylbutan-1-amine?
The IUPAC name of 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methyl-N-propan-2-ylbutan-1-amine (CID 79409091) is 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methyl-N-propan-2-ylbutan-1-amine.
What is the SMILES notation for 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methyl-N-propan-2-ylbutan-1-amine?
The canonical SMILES for 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methyl-N-propan-2-ylbutan-1-amine is Cc1nn(C(C)C(C)CNC(C)C)c(C)c1Br.
What is the InChIKey of 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methyl-N-propan-2-ylbutan-1-amine?
The InChIKey is LWJNWSGJMXWPPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24BrN3/c1-8(2)15-7-9(3)11(5)17-12(6)13(14)10(4)16-17/h8-9,11,15H,7H2,1-6H3.
What are the key properties of 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methyl-N-propan-2-ylbutan-1-amine?
3-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methyl-N-propan-2-ylbutan-1-amine has a molecular weight of 302.26 g/mol, XLogP of 3.46, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methyl-N-propan-2-ylbutan-1-amine is sourced from PubChem (CID 79409091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).