C14H32N2O2 — CID 79409379
3-N,3-N-bis(2-methoxyethyl)-2-methyl-1-N-propylbutane-1,3-diamine (PubChem CID 79409379) has the molecular formula C14H32N2O2 and a molecular weight of 260.42 g/mol. Its IUPAC name is 3-N,3-N-bis(2-methoxyethyl)-2-methyl-1-N-propylbutane-1,3-diamine.
| Compound Name | 3-N,3-N-bis(2-methoxyethyl)-2-methyl-1-N-propylbutane-1,3-diamine |
|---|---|
| PubChem CID | 79409379 |
| Molecular Formula | C14H32N2O2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.25 |
| IUPAC Name | 3-N,3-N-bis(2-methoxyethyl)-2-methyl-1-N-propylbutane-1,3-diamine |
| SMILES | CCCNCC(C)C(C)N(CCOC)CCOC |
| InChI | InChI=1S/C14H32N2O2/c1-6-7-15-12-13(2)14(3)16(8-10-17-4)9-11-18-5/h13-15H,6-12H2,1-5H3 |
| InChIKey | NHPRWQXMJUGTNZ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|