C13H19N3 — CID 79409526
3-(benzimidazol-1-yl)-N,2-dimethylbutan-1-amine (PubChem CID 79409526) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 3-(benzimidazol-1-yl)-N,2-dimethylbutan-1-amine.
| Compound Name | 3-(benzimidazol-1-yl)-N,2-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 79409526 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 3-(benzimidazol-1-yl)-N,2-dimethylbutan-1-amine |
| SMILES | CNCC(C)C(C)n1cnc2ccccc21 |
| InChI | InChI=1S/C13H19N3/c1-10(8-14-3)11(2)16-9-15-12-6-4-5-7-13(12)16/h4-7,9-11,14H,8H2,1-3H3 |
| InChIKey | MGGZLJFJIWTKDX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |