C10H13ClN2O2 — CID 79410495
(3S,4R)-1-[(2-chloro-4-pyridinyl)methyl]pyrrolidine-3,4-diol (PubChem CID 79410495) has the molecular formula C10H13ClN2O2 and a molecular weight of 228.68 g/mol. Its IUPAC name is (3S,4R)-1-[(2-chloro-4-pyridinyl)methyl]pyrrolidine-3,4-diol.
| Compound Name | (3S,4R)-1-[(2-chloro-4-pyridinyl)methyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 79410495 |
| Molecular Formula | C10H13ClN2O2 |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | (3S,4R)-1-[(2-chloro-4-pyridinyl)methyl]pyrrolidine-3,4-diol |
| SMILES | O[C@@H]1CN(Cc2ccnc(Cl)c2)C[C@@H]1O |
| InChI | InChI=1S/C10H13ClN2O2/c11-10-3-7(1-2-12-10)4-13-5-8(14)9(15)6-13/h1-3,8-9,14-15H,4-6H2/t8-,9+ |
| InChIKey | YKQRNYAOCAXJPJ-DTORHVGOSA-N |
| XLogP | 0.27 |
| TPSA | 56.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|