About propan-2-yl (3S,4R)-3,4-dihydroxypyrrolidine-1-carboxylate
propan-2-yl (3S,4R)-3,4-dihydroxypyrrolidine-1-carboxylate (PubChem CID 79410861) has the molecular formula C8H15NO4
and a molecular weight of 189.21 g/mol. Its IUPAC name is propan-2-yl (3S,4R)-3,4-dihydroxypyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl (3S,4R)-3,4-dihydroxypyrrolidine-1-carboxylate |
| PubChem CID | 79410861 |
| Molecular Formula | C8H15NO4 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | propan-2-yl (3S,4R)-3,4-dihydroxypyrrolidine-1-carboxylate |
| SMILES | CC(C)OC(=O)N1C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C8H15NO4/c1-5(2)13-8(12)9-3-6(10)7(11)4-9/h5-7,10-11H,3-4H2,1-2H3/t6-,7+ |
| InChIKey | SBBLWCSCTWCBTN-KNVOCYPGSA-N |
| XLogP | -0.43 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze propan-2-yl (3S,4R)-3,4-dihydroxypyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl (3S,4R)-3,4-dihydroxypyrrolidine-1-carboxylate?
The IUPAC name of propan-2-yl (3S,4R)-3,4-dihydroxypyrrolidine-1-carboxylate (CID 79410861) is propan-2-yl (3S,4R)-3,4-dihydroxypyrrolidine-1-carboxylate.
What is the SMILES notation for propan-2-yl (3S,4R)-3,4-dihydroxypyrrolidine-1-carboxylate?
The canonical SMILES for propan-2-yl (3S,4R)-3,4-dihydroxypyrrolidine-1-carboxylate is CC(C)OC(=O)N1C[C@@H](O)[C@@H](O)C1.
What is the InChIKey of propan-2-yl (3S,4R)-3,4-dihydroxypyrrolidine-1-carboxylate?
The InChIKey is SBBLWCSCTWCBTN-KNVOCYPGSA-N. The full InChI is InChI=1S/C8H15NO4/c1-5(2)13-8(12)9-3-6(10)7(11)4-9/h5-7,10-11H,3-4H2,1-2H3/t6-,7+.
What are the key properties of propan-2-yl (3S,4R)-3,4-dihydroxypyrrolidine-1-carboxylate?
propan-2-yl (3S,4R)-3,4-dihydroxypyrrolidine-1-carboxylate has a molecular weight of 189.21 g/mol, XLogP of -0.43, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl (3S,4R)-3,4-dihydroxypyrrolidine-1-carboxylate is sourced from PubChem (CID 79410861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).