About 3-(2-butyl-4,6-dimethylpyrimidin-5-yl)-N,2-dimethylpropan-1-amine
3-(2-butyl-4,6-dimethylpyrimidin-5-yl)-N,2-dimethylpropan-1-amine (PubChem CID 79412388) has the molecular formula C15H27N3
and a molecular weight of 249.40 g/mol. Its IUPAC name is 3-(2-butyl-4,6-dimethylpyrimidin-5-yl)-N,2-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-(2-butyl-4,6-dimethylpyrimidin-5-yl)-N,2-dimethylpropan-1-amine |
| PubChem CID | 79412388 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | 3-(2-butyl-4,6-dimethylpyrimidin-5-yl)-N,2-dimethylpropan-1-amine |
| SMILES | CCCCc1nc(C)c(CC(C)CNC)c(C)n1 |
| InChI | InChI=1S/C15H27N3/c1-6-7-8-15-17-12(3)14(13(4)18-15)9-11(2)10-16-5/h11,16H,6-10H2,1-5H3 |
| InChIKey | YKIBVXUQIIZOEH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-butyl-4,6-dimethylpyrimidin-5-yl)-N,2-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-butyl-4,6-dimethylpyrimidin-5-yl)-N,2-dimethylpropan-1-amine?
The IUPAC name of 3-(2-butyl-4,6-dimethylpyrimidin-5-yl)-N,2-dimethylpropan-1-amine (CID 79412388) is 3-(2-butyl-4,6-dimethylpyrimidin-5-yl)-N,2-dimethylpropan-1-amine.
What is the SMILES notation for 3-(2-butyl-4,6-dimethylpyrimidin-5-yl)-N,2-dimethylpropan-1-amine?
The canonical SMILES for 3-(2-butyl-4,6-dimethylpyrimidin-5-yl)-N,2-dimethylpropan-1-amine is CCCCc1nc(C)c(CC(C)CNC)c(C)n1.
What is the InChIKey of 3-(2-butyl-4,6-dimethylpyrimidin-5-yl)-N,2-dimethylpropan-1-amine?
The InChIKey is YKIBVXUQIIZOEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27N3/c1-6-7-8-15-17-12(3)14(13(4)18-15)9-11(2)10-16-5/h11,16H,6-10H2,1-5H3.
What are the key properties of 3-(2-butyl-4,6-dimethylpyrimidin-5-yl)-N,2-dimethylpropan-1-amine?
3-(2-butyl-4,6-dimethylpyrimidin-5-yl)-N,2-dimethylpropan-1-amine has a molecular weight of 249.40 g/mol, XLogP of 2.83, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-butyl-4,6-dimethylpyrimidin-5-yl)-N,2-dimethylpropan-1-amine is sourced from PubChem (CID 79412388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).