C14H18O4 — CID 79414442
4-(4-ethoxyphenyl)-2,3-dimethyl-4-oxobutanoic acid (PubChem CID 79414442) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is 4-(4-ethoxyphenyl)-2,3-dimethyl-4-oxobutanoic acid.
| Compound Name | 4-(4-ethoxyphenyl)-2,3-dimethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 79414442 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 4-(4-ethoxyphenyl)-2,3-dimethyl-4-oxobutanoic acid |
| SMILES | CCOc1ccc(C(=O)C(C)C(C)C(=O)O)cc1 |
| InChI | InChI=1S/C14H18O4/c1-4-18-12-7-5-11(6-8-12)13(15)9(2)10(3)14(16)17/h5-10H,4H2,1-3H3,(H,16,17) |
| InChIKey | NWQRDQHRTFOZKT-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |