About 3-N,2-dimethyl-3-N-[(4-methylphenyl)methyl]-1-N-propylbutane-1,3-diamine
3-N,2-dimethyl-3-N-[(4-methylphenyl)methyl]-1-N-propylbutane-1,3-diamine (PubChem CID 79414500) has the molecular formula C17H30N2
and a molecular weight of 262.44 g/mol. Its IUPAC name is 3-N,2-dimethyl-3-N-[(4-methylphenyl)methyl]-1-N-propylbutane-1,3-diamine.
Molecular Properties
| Compound Name | 3-N,2-dimethyl-3-N-[(4-methylphenyl)methyl]-1-N-propylbutane-1,3-diamine |
| PubChem CID | 79414500 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | 3-N,2-dimethyl-3-N-[(4-methylphenyl)methyl]-1-N-propylbutane-1,3-diamine |
| SMILES | CCCNCC(C)C(C)N(C)Cc1ccc(C)cc1 |
| InChI | InChI=1S/C17H30N2/c1-6-11-18-12-15(3)16(4)19(5)13-17-9-7-14(2)8-10-17/h7-10,15-16,18H,6,11-13H2,1-5H3 |
| InChIKey | HJIPDMCIQFLCKP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-N,2-dimethyl-3-N-[(4-methylphenyl)methyl]-1-N-propylbutane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N,2-dimethyl-3-N-[(4-methylphenyl)methyl]-1-N-propylbutane-1,3-diamine?
The IUPAC name of 3-N,2-dimethyl-3-N-[(4-methylphenyl)methyl]-1-N-propylbutane-1,3-diamine (CID 79414500) is 3-N,2-dimethyl-3-N-[(4-methylphenyl)methyl]-1-N-propylbutane-1,3-diamine.
What is the SMILES notation for 3-N,2-dimethyl-3-N-[(4-methylphenyl)methyl]-1-N-propylbutane-1,3-diamine?
The canonical SMILES for 3-N,2-dimethyl-3-N-[(4-methylphenyl)methyl]-1-N-propylbutane-1,3-diamine is CCCNCC(C)C(C)N(C)Cc1ccc(C)cc1.
What is the InChIKey of 3-N,2-dimethyl-3-N-[(4-methylphenyl)methyl]-1-N-propylbutane-1,3-diamine?
The InChIKey is HJIPDMCIQFLCKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30N2/c1-6-11-18-12-15(3)16(4)19(5)13-17-9-7-14(2)8-10-17/h7-10,15-16,18H,6,11-13H2,1-5H3.
What are the key properties of 3-N,2-dimethyl-3-N-[(4-methylphenyl)methyl]-1-N-propylbutane-1,3-diamine?
3-N,2-dimethyl-3-N-[(4-methylphenyl)methyl]-1-N-propylbutane-1,3-diamine has a molecular weight of 262.44 g/mol, XLogP of 3.45, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N,2-dimethyl-3-N-[(4-methylphenyl)methyl]-1-N-propylbutane-1,3-diamine is sourced from PubChem (CID 79414500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).