C13H19NS — CID 79414864
N,2,3,6-tetramethyl-3,4-dihydro-2H-thiochromen-4-amine (PubChem CID 79414864) has the molecular formula C13H19NS and a molecular weight of 221.37 g/mol. Its IUPAC name is N,2,3,6-tetramethyl-3,4-dihydro-2H-thiochromen-4-amine.
| Compound Name | N,2,3,6-tetramethyl-3,4-dihydro-2H-thiochromen-4-amine |
|---|---|
| PubChem CID | 79414864 |
| Molecular Formula | C13H19NS |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | N,2,3,6-tetramethyl-3,4-dihydro-2H-thiochromen-4-amine |
| SMILES | CNC1c2cc(C)ccc2SC(C)C1C |
| InChI | InChI=1S/C13H19NS/c1-8-5-6-12-11(7-8)13(14-4)9(2)10(3)15-12/h5-7,9-10,13-14H,1-4H3 |
| InChIKey | DLPVVEMVFXHFIF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |