C13H10Br3NO2 — CID 79415483
4-bromo-2-(2,5-dibromo-4-methoxyphenoxy)aniline (PubChem CID 79415483) has the molecular formula C13H10Br3NO2 and a molecular weight of 451.94 g/mol. Its IUPAC name is 4-bromo-2-(2,5-dibromo-4-methoxyphenoxy)aniline.
| Compound Name | 4-bromo-2-(2,5-dibromo-4-methoxyphenoxy)aniline |
|---|---|
| PubChem CID | 79415483 |
| Molecular Formula | C13H10Br3NO2 |
| Molecular Weight | 451.94 g/mol |
| Exact Mass | 448.83 |
| IUPAC Name | 4-bromo-2-(2,5-dibromo-4-methoxyphenoxy)aniline |
| SMILES | COc1cc(Br)c(Oc2cc(Br)ccc2N)cc1Br |
| InChI | InChI=1S/C13H10Br3NO2/c1-18-11-5-9(16)12(6-8(11)15)19-13-4-7(14)2-3-10(13)17/h2-6H,17H2,1H3 |
| InChIKey | GCPXUAKDLJRXKP-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.94 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|