C17H19N3O2 — CID 794172
N,N-diethyl-4-[(2-nitrophenyl)methylideneamino]aniline (PubChem CID 794172) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is N,N-diethyl-4-[(2-nitrophenyl)methylideneamino]aniline.
| Compound Name | N,N-diethyl-4-[(2-nitrophenyl)methylideneamino]aniline |
|---|---|
| PubChem CID | 794172 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N,N-diethyl-4-[(2-nitrophenyl)methylideneamino]aniline |
| SMILES | CCN(CC)c1ccc(/N=C/c2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H19N3O2/c1-3-19(4-2)16-11-9-15(10-12-16)18-13-14-7-5-6-8-17(14)20(21)22/h5-13H,3-4H2,1-2H3/b18-13+ |
| InChIKey | XGEMBWZUWCISAT-QGOAFFKASA-N |
| XLogP | 4.19 |
| TPSA | 58.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|