C16H16F2O — CID 79417400
3-(2,4-difluorophenyl)-2-(3-methylphenyl)propan-1-ol (PubChem CID 79417400) has the molecular formula C16H16F2O and a molecular weight of 262.30 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-2-(3-methylphenyl)propan-1-ol.
| Compound Name | 3-(2,4-difluorophenyl)-2-(3-methylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 79417400 |
| Molecular Formula | C16H16F2O |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 3-(2,4-difluorophenyl)-2-(3-methylphenyl)propan-1-ol |
| SMILES | Cc1cccc(C(CO)Cc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C16H16F2O/c1-11-3-2-4-12(7-11)14(10-19)8-13-5-6-15(17)9-16(13)18/h2-7,9,14,19H,8,10H2,1H3 |
| InChIKey | KFRSAIXPUFHCBD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |