C14H19FO4 — CID 79418064
5-ethoxy-2-[(3-fluorophenyl)methyl]-4-hydroxypentanoic acid (PubChem CID 79418064) has the molecular formula C14H19FO4 and a molecular weight of 270.30 g/mol. Its IUPAC name is 5-ethoxy-2-[(3-fluorophenyl)methyl]-4-hydroxypentanoic acid.
| Compound Name | 5-ethoxy-2-[(3-fluorophenyl)methyl]-4-hydroxypentanoic acid |
|---|---|
| PubChem CID | 79418064 |
| Molecular Formula | C14H19FO4 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 5-ethoxy-2-[(3-fluorophenyl)methyl]-4-hydroxypentanoic acid |
| SMILES | CCOCC(O)CC(Cc1cccc(F)c1)C(=O)O |
| InChI | InChI=1S/C14H19FO4/c1-2-19-9-13(16)8-11(14(17)18)6-10-4-3-5-12(15)7-10/h3-5,7,11,13,16H,2,6,8-9H2,1H3,(H,17,18) |
| InChIKey | ZZQZVMFTNKLELB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |