2-(1,1-dioxothiolan-3-yl)-4-hydroxy-5-methoxypentanoic acid

C10H18O6S — CID 79418100

IUPAC2-(1,1-dioxothiolan-3-yl)-4-hydroxy-5-methoxypentanoic acid
SMILESCOCC(O)CC(C(=O)O)C1CCS(=O)(=O)C1
InChIInChI=1S/C10H18O6S/c1-16-5-8(11)4-9(10(12)13)7-2-3-17(14,15)6-7/h7-9,11H,2-6H2,1H3,(H,12,13)
InChIKeyRELUXMQFIGHBBN-UHFFFAOYSA-N
MW266.31 g/mol
LogP-0.48
Rot. Bonds6

About 2-(1,1-dioxothiolan-3-yl)-4-hydroxy-5-methoxypentanoic acid

2-(1,1-dioxothiolan-3-yl)-4-hydroxy-5-methoxypentanoic acid (PubChem CID 79418100) has the molecular formula C10H18O6S and a molecular weight of 266.31 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-4-hydroxy-5-methoxypentanoic acid.

Molecular Properties

Compound Name2-(1,1-dioxothiolan-3-yl)-4-hydroxy-5-methoxypentanoic acid
PubChem CID79418100
Molecular FormulaC10H18O6S
Molecular Weight266.31 g/mol
Exact Mass266.08
IUPAC Name2-(1,1-dioxothiolan-3-yl)-4-hydroxy-5-methoxypentanoic acid
SMILESCOCC(O)CC(C(=O)O)C1CCS(=O)(=O)C1
InChIInChI=1S/C10H18O6S/c1-16-5-8(11)4-9(10(12)13)7-2-3-17(14,15)6-7/h7-9,11H,2-6H2,1H3,(H,12,13)
InChIKeyRELUXMQFIGHBBN-UHFFFAOYSA-N
XLogP-0.48
TPSA100.90 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.31
LogP ≤ 5-0.48
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-(1,1-dioxothiolan-3-yl)-4-hydroxy-5-methoxypentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,1-dioxothiolan-3-yl)-4-hydroxy-5-methoxypentanoic acid?
The IUPAC name of 2-(1,1-dioxothiolan-3-yl)-4-hydroxy-5-methoxypentanoic acid (CID 79418100) is 2-(1,1-dioxothiolan-3-yl)-4-hydroxy-5-methoxypentanoic acid.
What is the SMILES notation for 2-(1,1-dioxothiolan-3-yl)-4-hydroxy-5-methoxypentanoic acid?
The canonical SMILES for 2-(1,1-dioxothiolan-3-yl)-4-hydroxy-5-methoxypentanoic acid is COCC(O)CC(C(=O)O)C1CCS(=O)(=O)C1.
What is the InChIKey of 2-(1,1-dioxothiolan-3-yl)-4-hydroxy-5-methoxypentanoic acid?
The InChIKey is RELUXMQFIGHBBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O6S/c1-16-5-8(11)4-9(10(12)13)7-2-3-17(14,15)6-7/h7-9,11H,2-6H2,1H3,(H,12,13).
What are the key properties of 2-(1,1-dioxothiolan-3-yl)-4-hydroxy-5-methoxypentanoic acid?
2-(1,1-dioxothiolan-3-yl)-4-hydroxy-5-methoxypentanoic acid has a molecular weight of 266.31 g/mol, XLogP of -0.48, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dioxothiolan-3-yl)-4-hydroxy-5-methoxypentanoic acid is sourced from PubChem (CID 79418100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).