C13H19ClO — CID 79418606
1-(1-chloro-5-methoxypentan-2-yl)-2-methylbenzene (PubChem CID 79418606) has the molecular formula C13H19ClO and a molecular weight of 226.75 g/mol. Its IUPAC name is 1-(1-chloro-5-methoxypentan-2-yl)-2-methylbenzene.
| Compound Name | 1-(1-chloro-5-methoxypentan-2-yl)-2-methylbenzene |
|---|---|
| PubChem CID | 79418606 |
| Molecular Formula | C13H19ClO |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 1-(1-chloro-5-methoxypentan-2-yl)-2-methylbenzene |
| SMILES | COCCCC(CCl)c1ccccc1C |
| InChI | InChI=1S/C13H19ClO/c1-11-6-3-4-8-13(11)12(10-14)7-5-9-15-2/h3-4,6,8,12H,5,7,9-10H2,1-2H3 |
| InChIKey | DMEOQIXWSQZXSH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.75 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|