2-cyclopentyl-2-(1,1-dioxothiolan-3-yl)acetic acid

C11H18O4S — CID 79418832

IUPAC2-cyclopentyl-2-(1,1-dioxothiolan-3-yl)acetic acid
SMILESO=C(O)C(C1CCCC1)C1CCS(=O)(=O)C1
InChIInChI=1S/C11H18O4S/c12-11(13)10(8-3-1-2-4-8)9-5-6-16(14,15)7-9/h8-10H,1-7H2,(H,12,13)
InChIKeyXEEXOINRELFOCI-UHFFFAOYSA-N
MW246.33 g/mol
LogP1.31
Rot. Bonds3

About 2-cyclopentyl-2-(1,1-dioxothiolan-3-yl)acetic acid

2-cyclopentyl-2-(1,1-dioxothiolan-3-yl)acetic acid (PubChem CID 79418832) has the molecular formula C11H18O4S and a molecular weight of 246.33 g/mol. Its IUPAC name is 2-cyclopentyl-2-(1,1-dioxothiolan-3-yl)acetic acid.

Molecular Properties

Compound Name2-cyclopentyl-2-(1,1-dioxothiolan-3-yl)acetic acid
PubChem CID79418832
Molecular FormulaC11H18O4S
Molecular Weight246.33 g/mol
Exact Mass246.09
IUPAC Name2-cyclopentyl-2-(1,1-dioxothiolan-3-yl)acetic acid
SMILESO=C(O)C(C1CCCC1)C1CCS(=O)(=O)C1
InChIInChI=1S/C11H18O4S/c12-11(13)10(8-3-1-2-4-8)9-5-6-16(14,15)7-9/h8-10H,1-7H2,(H,12,13)
InChIKeyXEEXOINRELFOCI-UHFFFAOYSA-N
XLogP1.31
TPSA71.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.33
LogP ≤ 51.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-cyclopentyl-2-(1,1-dioxothiolan-3-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-cyclopentyl-2-(1,1-dioxothiolan-3-yl)acetic acid?
The IUPAC name of 2-cyclopentyl-2-(1,1-dioxothiolan-3-yl)acetic acid (CID 79418832) is 2-cyclopentyl-2-(1,1-dioxothiolan-3-yl)acetic acid.
What is the SMILES notation for 2-cyclopentyl-2-(1,1-dioxothiolan-3-yl)acetic acid?
The canonical SMILES for 2-cyclopentyl-2-(1,1-dioxothiolan-3-yl)acetic acid is O=C(O)C(C1CCCC1)C1CCS(=O)(=O)C1.
What is the InChIKey of 2-cyclopentyl-2-(1,1-dioxothiolan-3-yl)acetic acid?
The InChIKey is XEEXOINRELFOCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O4S/c12-11(13)10(8-3-1-2-4-8)9-5-6-16(14,15)7-9/h8-10H,1-7H2,(H,12,13).
What are the key properties of 2-cyclopentyl-2-(1,1-dioxothiolan-3-yl)acetic acid?
2-cyclopentyl-2-(1,1-dioxothiolan-3-yl)acetic acid has a molecular weight of 246.33 g/mol, XLogP of 1.31, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentyl-2-(1,1-dioxothiolan-3-yl)acetic acid is sourced from PubChem (CID 79418832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).