About 2-(1,1-dioxothiolan-3-yl)-2-(oxolan-3-yl)acetic acid
2-(1,1-dioxothiolan-3-yl)-2-(oxolan-3-yl)acetic acid (PubChem CID 79419159) has the molecular formula C10H16O5S
and a molecular weight of 248.30 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-2-(oxolan-3-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-2-(oxolan-3-yl)acetic acid |
| PubChem CID | 79419159 |
| Molecular Formula | C10H16O5S |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-2-(oxolan-3-yl)acetic acid |
| SMILES | O=C(O)C(C1CCOC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H16O5S/c11-10(12)9(7-1-3-15-5-7)8-2-4-16(13,14)6-8/h7-9H,1-6H2,(H,11,12) |
| InChIKey | ARGDTNXMODIDJA-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,1-dioxothiolan-3-yl)-2-(oxolan-3-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-dioxothiolan-3-yl)-2-(oxolan-3-yl)acetic acid?
The IUPAC name of 2-(1,1-dioxothiolan-3-yl)-2-(oxolan-3-yl)acetic acid (CID 79419159) is 2-(1,1-dioxothiolan-3-yl)-2-(oxolan-3-yl)acetic acid.
What is the SMILES notation for 2-(1,1-dioxothiolan-3-yl)-2-(oxolan-3-yl)acetic acid?
The canonical SMILES for 2-(1,1-dioxothiolan-3-yl)-2-(oxolan-3-yl)acetic acid is O=C(O)C(C1CCOC1)C1CCS(=O)(=O)C1.
What is the InChIKey of 2-(1,1-dioxothiolan-3-yl)-2-(oxolan-3-yl)acetic acid?
The InChIKey is ARGDTNXMODIDJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O5S/c11-10(12)9(7-1-3-15-5-7)8-2-4-16(13,14)6-8/h7-9H,1-6H2,(H,11,12).
What are the key properties of 2-(1,1-dioxothiolan-3-yl)-2-(oxolan-3-yl)acetic acid?
2-(1,1-dioxothiolan-3-yl)-2-(oxolan-3-yl)acetic acid has a molecular weight of 248.30 g/mol, XLogP of 0.16, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dioxothiolan-3-yl)-2-(oxolan-3-yl)acetic acid is sourced from PubChem (CID 79419159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).