C7H12F3NO2 — CID 79419596
(3R,4S)-1-(3,3,3-trifluoropropyl)pyrrolidine-3,4-diol (PubChem CID 79419596) has the molecular formula C7H12F3NO2 and a molecular weight of 199.17 g/mol. Its IUPAC name is (3R,4S)-1-(3,3,3-trifluoropropyl)pyrrolidine-3,4-diol.
| Compound Name | (3R,4S)-1-(3,3,3-trifluoropropyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 79419596 |
| Molecular Formula | C7H12F3NO2 |
| Molecular Weight | 199.17 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | (3R,4S)-1-(3,3,3-trifluoropropyl)pyrrolidine-3,4-diol |
| SMILES | O[C@@H]1CN(CCC(F)(F)F)C[C@@H]1O |
| InChI | InChI=1S/C7H12F3NO2/c8-7(9,10)1-2-11-3-5(12)6(13)4-11/h5-6,12-13H,1-4H2/t5-,6+ |
| InChIKey | QWZVTZQCQDQVDN-OLQVQODUSA-N |
| XLogP | -0.02 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.17 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |