C15H25N — CID 79421796
N-ethyl-2-(2-methylphenyl)hexan-1-amine (PubChem CID 79421796) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is N-ethyl-2-(2-methylphenyl)hexan-1-amine.
| Compound Name | N-ethyl-2-(2-methylphenyl)hexan-1-amine |
|---|---|
| PubChem CID | 79421796 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | N-ethyl-2-(2-methylphenyl)hexan-1-amine |
| SMILES | CCCCC(CNCC)c1ccccc1C |
| InChI | InChI=1S/C15H25N/c1-4-6-10-14(12-16-5-2)15-11-8-7-9-13(15)3/h7-9,11,14,16H,4-6,10,12H2,1-3H3 |
| InChIKey | CNOSIHHJZHBGIP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |