C13H9BrCl2N2O2 — CID 79421839
N-(4-bromo-3-methoxyphenyl)-3,6-dichloropyridine-2-carboxamide (PubChem CID 79421839) has the molecular formula C13H9BrCl2N2O2 and a molecular weight of 376.04 g/mol. Its IUPAC name is N-(4-bromo-3-methoxyphenyl)-3,6-dichloropyridine-2-carboxamide.
| Compound Name | N-(4-bromo-3-methoxyphenyl)-3,6-dichloropyridine-2-carboxamide |
|---|---|
| PubChem CID | 79421839 |
| Molecular Formula | C13H9BrCl2N2O2 |
| Molecular Weight | 376.04 g/mol |
| Exact Mass | 373.92 |
| IUPAC Name | N-(4-bromo-3-methoxyphenyl)-3,6-dichloropyridine-2-carboxamide |
| SMILES | COc1cc(NC(=O)c2nc(Cl)ccc2Cl)ccc1Br |
| InChI | InChI=1S/C13H9BrCl2N2O2/c1-20-10-6-7(2-3-8(10)14)17-13(19)12-9(15)4-5-11(16)18-12/h2-6H,1H3,(H,17,19) |
| InChIKey | DZDZFMQXSYTRIK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.04 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|