C13H17BrO2S — CID 79422119
3-[2-bromo-1-(3-methylphenyl)ethyl]thiolane 1,1-dioxide (PubChem CID 79422119) has the molecular formula C13H17BrO2S and a molecular weight of 317.25 g/mol. Its IUPAC name is 3-[2-bromo-1-(3-methylphenyl)ethyl]thiolane 1,1-dioxide.
| Compound Name | 3-[2-bromo-1-(3-methylphenyl)ethyl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 79422119 |
| Molecular Formula | C13H17BrO2S |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 3-[2-bromo-1-(3-methylphenyl)ethyl]thiolane 1,1-dioxide |
| SMILES | Cc1cccc(C(CBr)C2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C13H17BrO2S/c1-10-3-2-4-11(7-10)13(8-14)12-5-6-17(15,16)9-12/h2-4,7,12-13H,5-6,8-9H2,1H3 |
| InChIKey | KHBQYFOLIBIFCC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.25 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|