About 2-(1-amino-2,2-dimethylpropyl)-4-hydroxy-5-(3-methylphenyl)-1H-pyrimidin-6-one
2-(1-amino-2,2-dimethylpropyl)-4-hydroxy-5-(3-methylphenyl)-1H-pyrimidin-6-one (PubChem CID 79422302) has the molecular formula C16H21N3O2
and a molecular weight of 287.36 g/mol. Its IUPAC name is 2-(1-amino-2,2-dimethylpropyl)-4-hydroxy-5-(3-methylphenyl)-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-(1-amino-2,2-dimethylpropyl)-4-hydroxy-5-(3-methylphenyl)-1H-pyrimidin-6-one |
| PubChem CID | 79422302 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 2-(1-amino-2,2-dimethylpropyl)-4-hydroxy-5-(3-methylphenyl)-1H-pyrimidin-6-one |
| SMILES | Cc1cccc(-c2c(O)nc(C(N)C(C)(C)C)[nH]c2=O)c1 |
| InChI | InChI=1S/C16H21N3O2/c1-9-6-5-7-10(8-9)11-14(20)18-13(19-15(11)21)12(17)16(2,3)4/h5-8,12H,17H2,1-4H3,(H2,18,19,20,21) |
| InChIKey | DLNTTWUQGSHVNM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1-amino-2,2-dimethylpropyl)-4-hydroxy-5-(3-methylphenyl)-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-amino-2,2-dimethylpropyl)-4-hydroxy-5-(3-methylphenyl)-1H-pyrimidin-6-one?
The IUPAC name of 2-(1-amino-2,2-dimethylpropyl)-4-hydroxy-5-(3-methylphenyl)-1H-pyrimidin-6-one (CID 79422302) is 2-(1-amino-2,2-dimethylpropyl)-4-hydroxy-5-(3-methylphenyl)-1H-pyrimidin-6-one.
What is the SMILES notation for 2-(1-amino-2,2-dimethylpropyl)-4-hydroxy-5-(3-methylphenyl)-1H-pyrimidin-6-one?
The canonical SMILES for 2-(1-amino-2,2-dimethylpropyl)-4-hydroxy-5-(3-methylphenyl)-1H-pyrimidin-6-one is Cc1cccc(-c2c(O)nc(C(N)C(C)(C)C)[nH]c2=O)c1.
What is the InChIKey of 2-(1-amino-2,2-dimethylpropyl)-4-hydroxy-5-(3-methylphenyl)-1H-pyrimidin-6-one?
The InChIKey is DLNTTWUQGSHVNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O2/c1-9-6-5-7-10(8-9)11-14(20)18-13(19-15(11)21)12(17)16(2,3)4/h5-8,12H,17H2,1-4H3,(H2,18,19,20,21).
What are the key properties of 2-(1-amino-2,2-dimethylpropyl)-4-hydroxy-5-(3-methylphenyl)-1H-pyrimidin-6-one?
2-(1-amino-2,2-dimethylpropyl)-4-hydroxy-5-(3-methylphenyl)-1H-pyrimidin-6-one has a molecular weight of 287.36 g/mol, XLogP of 2.50, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-amino-2,2-dimethylpropyl)-4-hydroxy-5-(3-methylphenyl)-1H-pyrimidin-6-one is sourced from PubChem (CID 79422302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).