C9H17F3O2 — CID 79423648
1,1,1-trifluoro-4-propan-2-ylhexane-2,5-diol (PubChem CID 79423648) has the molecular formula C9H17F3O2 and a molecular weight of 214.23 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-propan-2-ylhexane-2,5-diol.
| Compound Name | 1,1,1-trifluoro-4-propan-2-ylhexane-2,5-diol |
|---|---|
| PubChem CID | 79423648 |
| Molecular Formula | C9H17F3O2 |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 1,1,1-trifluoro-4-propan-2-ylhexane-2,5-diol |
| SMILES | CC(C)C(CC(O)C(F)(F)F)C(C)O |
| InChI | InChI=1S/C9H17F3O2/c1-5(2)7(6(3)13)4-8(14)9(10,11)12/h5-8,13-14H,4H2,1-3H3 |
| InChIKey | PGCAGHFSOPFRDD-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |