C12H14O2 — CID 794240
2,3,6,7,8,9-hexahydrobenzo[g][1,4]benzodioxine (PubChem CID 794240) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is 2,3,6,7,8,9-hexahydrobenzo[g][1,4]benzodioxine.
| Compound Name | 2,3,6,7,8,9-hexahydrobenzo[g][1,4]benzodioxine |
|---|---|
| PubChem CID | 794240 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 2,3,6,7,8,9-hexahydrobenzo[g][1,4]benzodioxine |
| SMILES | c1c2c(cc3c1OCCO3)CCCC2 |
| InChI | InChI=1S/C12H14O2/c1-2-4-10-8-12-11(7-9(10)3-1)13-5-6-14-12/h7-8H,1-6H2 |
| InChIKey | JZDFJQUEOWGAFO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |