C8H11F3O4S — CID 79425104
2-(1,1-dioxothiolan-3-yl)-4,4,4-trifluorobutanoic acid (PubChem CID 79425104) has the molecular formula C8H11F3O4S and a molecular weight of 260.23 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-4,4,4-trifluorobutanoic acid.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-4,4,4-trifluorobutanoic acid |
|---|---|
| PubChem CID | 79425104 |
| Molecular Formula | C8H11F3O4S |
| Molecular Weight | 260.23 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-4,4,4-trifluorobutanoic acid |
| SMILES | O=C(O)C(CC(F)(F)F)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H11F3O4S/c9-8(10,11)3-6(7(12)13)5-1-2-16(14,15)4-5/h5-6H,1-4H2,(H,12,13) |
| InChIKey | LYLSQSQZRYFPBU-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.23 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |