About 4-(4-hydroxy-1,1-dioxothiolan-3-yl)oxane-4-carboxylic acid
4-(4-hydroxy-1,1-dioxothiolan-3-yl)oxane-4-carboxylic acid (PubChem CID 79425724) has the molecular formula C10H16O6S
and a molecular weight of 264.30 g/mol. Its IUPAC name is 4-(4-hydroxy-1,1-dioxothiolan-3-yl)oxane-4-carboxylic acid.
Molecular Properties
| Compound Name | 4-(4-hydroxy-1,1-dioxothiolan-3-yl)oxane-4-carboxylic acid |
| PubChem CID | 79425724 |
| Molecular Formula | C10H16O6S |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 4-(4-hydroxy-1,1-dioxothiolan-3-yl)oxane-4-carboxylic acid |
| SMILES | O=C(O)C1(C2CS(=O)(=O)CC2O)CCOCC1 |
| InChI | InChI=1S/C10H16O6S/c11-8-6-17(14,15)5-7(8)10(9(12)13)1-3-16-4-2-10/h7-8,11H,1-6H2,(H,12,13) |
| InChIKey | CYRDLMJSFYJOSN-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(4-hydroxy-1,1-dioxothiolan-3-yl)oxane-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-hydroxy-1,1-dioxothiolan-3-yl)oxane-4-carboxylic acid?
The IUPAC name of 4-(4-hydroxy-1,1-dioxothiolan-3-yl)oxane-4-carboxylic acid (CID 79425724) is 4-(4-hydroxy-1,1-dioxothiolan-3-yl)oxane-4-carboxylic acid.
What is the SMILES notation for 4-(4-hydroxy-1,1-dioxothiolan-3-yl)oxane-4-carboxylic acid?
The canonical SMILES for 4-(4-hydroxy-1,1-dioxothiolan-3-yl)oxane-4-carboxylic acid is O=C(O)C1(C2CS(=O)(=O)CC2O)CCOCC1.
What is the InChIKey of 4-(4-hydroxy-1,1-dioxothiolan-3-yl)oxane-4-carboxylic acid?
The InChIKey is CYRDLMJSFYJOSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O6S/c11-8-6-17(14,15)5-7(8)10(9(12)13)1-3-16-4-2-10/h7-8,11H,1-6H2,(H,12,13).
What are the key properties of 4-(4-hydroxy-1,1-dioxothiolan-3-yl)oxane-4-carboxylic acid?
4-(4-hydroxy-1,1-dioxothiolan-3-yl)oxane-4-carboxylic acid has a molecular weight of 264.30 g/mol, XLogP of -0.73, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-hydroxy-1,1-dioxothiolan-3-yl)oxane-4-carboxylic acid is sourced from PubChem (CID 79425724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).