About 1-(4-hydroxy-1,1-dioxothiolan-3-yl)-3-methylcyclohexane-1-carboxylic acid
1-(4-hydroxy-1,1-dioxothiolan-3-yl)-3-methylcyclohexane-1-carboxylic acid (PubChem CID 79425853) has the molecular formula C12H20O5S
and a molecular weight of 276.35 g/mol. Its IUPAC name is 1-(4-hydroxy-1,1-dioxothiolan-3-yl)-3-methylcyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-(4-hydroxy-1,1-dioxothiolan-3-yl)-3-methylcyclohexane-1-carboxylic acid |
| PubChem CID | 79425853 |
| Molecular Formula | C12H20O5S |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 1-(4-hydroxy-1,1-dioxothiolan-3-yl)-3-methylcyclohexane-1-carboxylic acid |
| SMILES | CC1CCCC(C(=O)O)(C2CS(=O)(=O)CC2O)C1 |
| InChI | InChI=1S/C12H20O5S/c1-8-3-2-4-12(5-8,11(14)15)9-6-18(16,17)7-10(9)13/h8-10,13H,2-7H2,1H3,(H,14,15) |
| InChIKey | NVDMBCFHJLZZCV-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-hydroxy-1,1-dioxothiolan-3-yl)-3-methylcyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-hydroxy-1,1-dioxothiolan-3-yl)-3-methylcyclohexane-1-carboxylic acid?
The IUPAC name of 1-(4-hydroxy-1,1-dioxothiolan-3-yl)-3-methylcyclohexane-1-carboxylic acid (CID 79425853) is 1-(4-hydroxy-1,1-dioxothiolan-3-yl)-3-methylcyclohexane-1-carboxylic acid.
What is the SMILES notation for 1-(4-hydroxy-1,1-dioxothiolan-3-yl)-3-methylcyclohexane-1-carboxylic acid?
The canonical SMILES for 1-(4-hydroxy-1,1-dioxothiolan-3-yl)-3-methylcyclohexane-1-carboxylic acid is CC1CCCC(C(=O)O)(C2CS(=O)(=O)CC2O)C1.
What is the InChIKey of 1-(4-hydroxy-1,1-dioxothiolan-3-yl)-3-methylcyclohexane-1-carboxylic acid?
The InChIKey is NVDMBCFHJLZZCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O5S/c1-8-3-2-4-12(5-8,11(14)15)9-6-18(16,17)7-10(9)13/h8-10,13H,2-7H2,1H3,(H,14,15).
What are the key properties of 1-(4-hydroxy-1,1-dioxothiolan-3-yl)-3-methylcyclohexane-1-carboxylic acid?
1-(4-hydroxy-1,1-dioxothiolan-3-yl)-3-methylcyclohexane-1-carboxylic acid has a molecular weight of 276.35 g/mol, XLogP of 0.67, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-hydroxy-1,1-dioxothiolan-3-yl)-3-methylcyclohexane-1-carboxylic acid is sourced from PubChem (CID 79425853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).