C13H19ClN2S — CID 79426863
5-[(4-chlorothiophen-2-yl)methyl]-4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 79426863) has the molecular formula C13H19ClN2S and a molecular weight of 270.83 g/mol. Its IUPAC name is 5-[(4-chlorothiophen-2-yl)methyl]-4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 5-[(4-chlorothiophen-2-yl)methyl]-4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 79426863 |
| Molecular Formula | C13H19ClN2S |
| Molecular Weight | 270.83 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 5-[(4-chlorothiophen-2-yl)methyl]-4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | CC1(C)C2CNCC2CN1Cc1cc(Cl)cs1 |
| InChI | InChI=1S/C13H19ClN2S/c1-13(2)12-5-15-4-9(12)6-16(13)7-11-3-10(14)8-17-11/h3,8-9,12,15H,4-7H2,1-2H3 |
| InChIKey | DGFWBPJSRNLOOS-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.83 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |