C9H12ClNS2 — CID 79427656
2-(4-chlorothiophen-2-yl)-4-methyl-1,3-thiazinane (PubChem CID 79427656) has the molecular formula C9H12ClNS2 and a molecular weight of 233.79 g/mol. Its IUPAC name is 2-(4-chlorothiophen-2-yl)-4-methyl-1,3-thiazinane.
| Compound Name | 2-(4-chlorothiophen-2-yl)-4-methyl-1,3-thiazinane |
|---|---|
| PubChem CID | 79427656 |
| Molecular Formula | C9H12ClNS2 |
| Molecular Weight | 233.79 g/mol |
| Exact Mass | 233.01 |
| IUPAC Name | 2-(4-chlorothiophen-2-yl)-4-methyl-1,3-thiazinane |
| SMILES | CC1CCSC(c2cc(Cl)cs2)N1 |
| InChI | InChI=1S/C9H12ClNS2/c1-6-2-3-12-9(11-6)8-4-7(10)5-13-8/h4-6,9,11H,2-3H2,1H3 |
| InChIKey | NGDPLTYTGVNESV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.79 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |