About 1-(4-chlorothiophen-2-yl)-N,N-diethylethane-1,2-diamine
1-(4-chlorothiophen-2-yl)-N,N-diethylethane-1,2-diamine (PubChem CID 79427710) has the molecular formula C10H17ClN2S
and a molecular weight of 232.78 g/mol. Its IUPAC name is 1-(4-chlorothiophen-2-yl)-N,N-diethylethane-1,2-diamine.
Molecular Properties
| Compound Name | 1-(4-chlorothiophen-2-yl)-N,N-diethylethane-1,2-diamine |
| PubChem CID | 79427710 |
| Molecular Formula | C10H17ClN2S |
| Molecular Weight | 232.78 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 1-(4-chlorothiophen-2-yl)-N,N-diethylethane-1,2-diamine |
| SMILES | CCN(CC)C(CN)c1cc(Cl)cs1 |
| InChI | InChI=1S/C10H17ClN2S/c1-3-13(4-2)9(6-12)10-5-8(11)7-14-10/h5,7,9H,3-4,6,12H2,1-2H3 |
| InChIKey | BHXYNGVUNHTCJE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.78 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-chlorothiophen-2-yl)-N,N-diethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorothiophen-2-yl)-N,N-diethylethane-1,2-diamine?
The IUPAC name of 1-(4-chlorothiophen-2-yl)-N,N-diethylethane-1,2-diamine (CID 79427710) is 1-(4-chlorothiophen-2-yl)-N,N-diethylethane-1,2-diamine.
What is the SMILES notation for 1-(4-chlorothiophen-2-yl)-N,N-diethylethane-1,2-diamine?
The canonical SMILES for 1-(4-chlorothiophen-2-yl)-N,N-diethylethane-1,2-diamine is CCN(CC)C(CN)c1cc(Cl)cs1.
What is the InChIKey of 1-(4-chlorothiophen-2-yl)-N,N-diethylethane-1,2-diamine?
The InChIKey is BHXYNGVUNHTCJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17ClN2S/c1-3-13(4-2)9(6-12)10-5-8(11)7-14-10/h5,7,9H,3-4,6,12H2,1-2H3.
What are the key properties of 1-(4-chlorothiophen-2-yl)-N,N-diethylethane-1,2-diamine?
1-(4-chlorothiophen-2-yl)-N,N-diethylethane-1,2-diamine has a molecular weight of 232.78 g/mol, XLogP of 2.74, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorothiophen-2-yl)-N,N-diethylethane-1,2-diamine is sourced from PubChem (CID 79427710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).