C14H19FN2OS — CID 794282
(6R)-1-[(4-fluorophenyl)methyl]-6-hydroxy-4,4,6-trimethyl-1,3-diazinane-2-thione (PubChem CID 794282) has the molecular formula C14H19FN2OS and a molecular weight of 282.38 g/mol. Its IUPAC name is (6R)-1-[(4-fluorophenyl)methyl]-6-hydroxy-4,4,6-trimethyl-1,3-diazinane-2-thione.
| Compound Name | (6R)-1-[(4-fluorophenyl)methyl]-6-hydroxy-4,4,6-trimethyl-1,3-diazinane-2-thione |
|---|---|
| PubChem CID | 794282 |
| Molecular Formula | C14H19FN2OS |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | (6R)-1-[(4-fluorophenyl)methyl]-6-hydroxy-4,4,6-trimethyl-1,3-diazinane-2-thione |
| SMILES | CC1(C)C[C@@](C)(O)N(Cc2ccc(F)cc2)C(=S)N1 |
| InChI | InChI=1S/C14H19FN2OS/c1-13(2)9-14(3,18)17(12(19)16-13)8-10-4-6-11(15)7-5-10/h4-7,18H,8-9H2,1-3H3,(H,16,19)/t14-/m1/s1 |
| InChIKey | TVGFGLHPNWNLHL-CQSZACIVSA-N |
| XLogP | 2.39 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|