About 2-(1,3-thiazol-4-ylmethyl)-3,4-dihydro-2H-naphthalen-1-one
2-(1,3-thiazol-4-ylmethyl)-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 79428825) has the molecular formula C14H13NOS
and a molecular weight of 243.33 g/mol. Its IUPAC name is 2-(1,3-thiazol-4-ylmethyl)-3,4-dihydro-2H-naphthalen-1-one.
Molecular Properties
| Compound Name | 2-(1,3-thiazol-4-ylmethyl)-3,4-dihydro-2H-naphthalen-1-one |
| PubChem CID | 79428825 |
| Molecular Formula | C14H13NOS |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 2-(1,3-thiazol-4-ylmethyl)-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | O=C1c2ccccc2CCC1Cc1cscn1 |
| InChI | InChI=1S/C14H13NOS/c16-14-11(7-12-8-17-9-15-12)6-5-10-3-1-2-4-13(10)14/h1-4,8-9,11H,5-7H2 |
| InChIKey | SUCDPZCDPRGXIV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1,3-thiazol-4-ylmethyl)-3,4-dihydro-2H-naphthalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-thiazol-4-ylmethyl)-3,4-dihydro-2H-naphthalen-1-one?
The IUPAC name of 2-(1,3-thiazol-4-ylmethyl)-3,4-dihydro-2H-naphthalen-1-one (CID 79428825) is 2-(1,3-thiazol-4-ylmethyl)-3,4-dihydro-2H-naphthalen-1-one.
What is the SMILES notation for 2-(1,3-thiazol-4-ylmethyl)-3,4-dihydro-2H-naphthalen-1-one?
The canonical SMILES for 2-(1,3-thiazol-4-ylmethyl)-3,4-dihydro-2H-naphthalen-1-one is O=C1c2ccccc2CCC1Cc1cscn1.
What is the InChIKey of 2-(1,3-thiazol-4-ylmethyl)-3,4-dihydro-2H-naphthalen-1-one?
The InChIKey is SUCDPZCDPRGXIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NOS/c16-14-11(7-12-8-17-9-15-12)6-5-10-3-1-2-4-13(10)14/h1-4,8-9,11H,5-7H2.
What are the key properties of 2-(1,3-thiazol-4-ylmethyl)-3,4-dihydro-2H-naphthalen-1-one?
2-(1,3-thiazol-4-ylmethyl)-3,4-dihydro-2H-naphthalen-1-one has a molecular weight of 243.33 g/mol, XLogP of 3.13, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-thiazol-4-ylmethyl)-3,4-dihydro-2H-naphthalen-1-one is sourced from PubChem (CID 79428825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).