4,4-dimethyl-1-(3-methylbut-2-enyl)cyclohexane-1-carboxylic acid

C14H24O2 — CID 79428838

IUPAC4,4-dimethyl-1-(3-methylbut-2-enyl)cyclohexane-1-carboxylic acid
SMILESCC(C)=CCC1(C(=O)O)CCC(C)(C)CC1
InChIInChI=1S/C14H24O2/c1-11(2)5-6-14(12(15)16)9-7-13(3,4)8-10-14/h5H,6-10H2,1-4H3,(H,15,16)
InChIKeyGONNFRMQUNZUBF-UHFFFAOYSA-N
MW224.34 g/mol
LogP4.01
Rot. Bonds3

About 4,4-dimethyl-1-(3-methylbut-2-enyl)cyclohexane-1-carboxylic acid

4,4-dimethyl-1-(3-methylbut-2-enyl)cyclohexane-1-carboxylic acid (PubChem CID 79428838) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is 4,4-dimethyl-1-(3-methylbut-2-enyl)cyclohexane-1-carboxylic acid.

Molecular Properties

Compound Name4,4-dimethyl-1-(3-methylbut-2-enyl)cyclohexane-1-carboxylic acid
PubChem CID79428838
Molecular FormulaC14H24O2
Molecular Weight224.34 g/mol
Exact Mass224.18
IUPAC Name4,4-dimethyl-1-(3-methylbut-2-enyl)cyclohexane-1-carboxylic acid
SMILESCC(C)=CCC1(C(=O)O)CCC(C)(C)CC1
InChIInChI=1S/C14H24O2/c1-11(2)5-6-14(12(15)16)9-7-13(3,4)8-10-14/h5H,6-10H2,1-4H3,(H,15,16)
InChIKeyGONNFRMQUNZUBF-UHFFFAOYSA-N
XLogP4.01
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.34
LogP ≤ 54.01
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 4,4-dimethyl-1-(3-methylbut-2-enyl)cyclohexane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,4-dimethyl-1-(3-methylbut-2-enyl)cyclohexane-1-carboxylic acid?
The IUPAC name of 4,4-dimethyl-1-(3-methylbut-2-enyl)cyclohexane-1-carboxylic acid (CID 79428838) is 4,4-dimethyl-1-(3-methylbut-2-enyl)cyclohexane-1-carboxylic acid.
What is the SMILES notation for 4,4-dimethyl-1-(3-methylbut-2-enyl)cyclohexane-1-carboxylic acid?
The canonical SMILES for 4,4-dimethyl-1-(3-methylbut-2-enyl)cyclohexane-1-carboxylic acid is CC(C)=CCC1(C(=O)O)CCC(C)(C)CC1.
What is the InChIKey of 4,4-dimethyl-1-(3-methylbut-2-enyl)cyclohexane-1-carboxylic acid?
The InChIKey is GONNFRMQUNZUBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O2/c1-11(2)5-6-14(12(15)16)9-7-13(3,4)8-10-14/h5H,6-10H2,1-4H3,(H,15,16).
What are the key properties of 4,4-dimethyl-1-(3-methylbut-2-enyl)cyclohexane-1-carboxylic acid?
4,4-dimethyl-1-(3-methylbut-2-enyl)cyclohexane-1-carboxylic acid has a molecular weight of 224.34 g/mol, XLogP of 4.01, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-1-(3-methylbut-2-enyl)cyclohexane-1-carboxylic acid is sourced from PubChem (CID 79428838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).