About 3-ethyl-1-(3,3,3-trifluoropropyl)cyclohexane-1-carboxylic acid
3-ethyl-1-(3,3,3-trifluoropropyl)cyclohexane-1-carboxylic acid (PubChem CID 79428854) has the molecular formula C12H19F3O2
and a molecular weight of 252.28 g/mol. Its IUPAC name is 3-ethyl-1-(3,3,3-trifluoropropyl)cyclohexane-1-carboxylic acid.
Analyze 3-ethyl-1-(3,3,3-trifluoropropyl)cyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1-(3,3,3-trifluoropropyl)cyclohexane-1-carboxylic acid?
The IUPAC name of 3-ethyl-1-(3,3,3-trifluoropropyl)cyclohexane-1-carboxylic acid (CID 79428854) is 3-ethyl-1-(3,3,3-trifluoropropyl)cyclohexane-1-carboxylic acid.
What is the SMILES notation for 3-ethyl-1-(3,3,3-trifluoropropyl)cyclohexane-1-carboxylic acid?
The canonical SMILES for 3-ethyl-1-(3,3,3-trifluoropropyl)cyclohexane-1-carboxylic acid is CCC1CCCC(CCC(F)(F)F)(C(=O)O)C1.
What is the InChIKey of 3-ethyl-1-(3,3,3-trifluoropropyl)cyclohexane-1-carboxylic acid?
The InChIKey is KGHRNTTUSSAIAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19F3O2/c1-2-9-4-3-5-11(8-9,10(16)17)6-7-12(13,14)15/h9H,2-8H2,1H3,(H,16,17).
What are the key properties of 3-ethyl-1-(3,3,3-trifluoropropyl)cyclohexane-1-carboxylic acid?
3-ethyl-1-(3,3,3-trifluoropropyl)cyclohexane-1-carboxylic acid has a molecular weight of 252.28 g/mol, XLogP of 4.00, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1-(3,3,3-trifluoropropyl)cyclohexane-1-carboxylic acid is sourced from PubChem (CID 79428854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).