About 2-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]cyclopentan-1-one
2-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]cyclopentan-1-one (PubChem CID 79429298) has the molecular formula C9H12N2O2
and a molecular weight of 180.21 g/mol. Its IUPAC name is 2-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]cyclopentan-1-one.
Molecular Properties
| Compound Name | 2-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]cyclopentan-1-one |
| PubChem CID | 79429298 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 2-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]cyclopentan-1-one |
| SMILES | Cc1nonc1CC1CCCC1=O |
| InChI | InChI=1S/C9H12N2O2/c1-6-8(11-13-10-6)5-7-3-2-4-9(7)12/h7H,2-5H2,1H3 |
| InChIKey | LSUVTWGEIKZJIA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]cyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]cyclopentan-1-one?
The IUPAC name of 2-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]cyclopentan-1-one (CID 79429298) is 2-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]cyclopentan-1-one.
What is the SMILES notation for 2-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]cyclopentan-1-one?
The canonical SMILES for 2-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]cyclopentan-1-one is Cc1nonc1CC1CCCC1=O.
What is the InChIKey of 2-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]cyclopentan-1-one?
The InChIKey is LSUVTWGEIKZJIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2/c1-6-8(11-13-10-6)5-7-3-2-4-9(7)12/h7H,2-5H2,1H3.
What are the key properties of 2-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]cyclopentan-1-one?
2-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]cyclopentan-1-one has a molecular weight of 180.21 g/mol, XLogP of 1.29, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]cyclopentan-1-one is sourced from PubChem (CID 79429298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).