C15H18O2 — CID 79429733
2-(cyclobutylmethyl)-1,3-dihydroindene-2-carboxylic acid (PubChem CID 79429733) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is 2-(cyclobutylmethyl)-1,3-dihydroindene-2-carboxylic acid.
| Compound Name | 2-(cyclobutylmethyl)-1,3-dihydroindene-2-carboxylic acid |
|---|---|
| PubChem CID | 79429733 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 2-(cyclobutylmethyl)-1,3-dihydroindene-2-carboxylic acid |
| SMILES | O=C(O)C1(CC2CCC2)Cc2ccccc2C1 |
| InChI | InChI=1S/C15H18O2/c16-14(17)15(8-11-4-3-5-11)9-12-6-1-2-7-13(12)10-15/h1-2,6-7,11H,3-5,8-10H2,(H,16,17) |
| InChIKey | WZAXBKVJNYLJIC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |