C15H11FN2O3 — CID 79431661
5-(3-fluorophenyl)-4-hydroxy-2-(5-methylfuran-2-yl)-1H-pyrimidin-6-one (PubChem CID 79431661) has the molecular formula C15H11FN2O3 and a molecular weight of 286.26 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-4-hydroxy-2-(5-methylfuran-2-yl)-1H-pyrimidin-6-one.
| Compound Name | 5-(3-fluorophenyl)-4-hydroxy-2-(5-methylfuran-2-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 79431661 |
| Molecular Formula | C15H11FN2O3 |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 5-(3-fluorophenyl)-4-hydroxy-2-(5-methylfuran-2-yl)-1H-pyrimidin-6-one |
| SMILES | Cc1ccc(-c2nc(O)c(-c3cccc(F)c3)c(=O)[nH]2)o1 |
| InChI | InChI=1S/C15H11FN2O3/c1-8-5-6-11(21-8)13-17-14(19)12(15(20)18-13)9-3-2-4-10(16)7-9/h2-7H,1H3,(H2,17,18,19,20) |
| InChIKey | VLPIPBUETWMNMW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |