C14H14O5 — CID 794317
2-(6-ethyl-4-methyl-2-oxochromen-7-yl)oxyacetic acid (PubChem CID 794317) has the molecular formula C14H14O5 and a molecular weight of 262.26 g/mol. Its IUPAC name is 2-(6-ethyl-4-methyl-2-oxochromen-7-yl)oxyacetic acid.
| Compound Name | 2-(6-ethyl-4-methyl-2-oxochromen-7-yl)oxyacetic acid |
|---|---|
| PubChem CID | 794317 |
| Molecular Formula | C14H14O5 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 2-(6-ethyl-4-methyl-2-oxochromen-7-yl)oxyacetic acid |
| SMILES | CCc1cc2c(C)cc(=O)oc2cc1OCC(=O)O |
| InChI | InChI=1S/C14H14O5/c1-3-9-5-10-8(2)4-14(17)19-12(10)6-11(9)18-7-13(15)16/h4-6H,3,7H2,1-2H3,(H,15,16) |
| InChIKey | NJCUFSPOSZSDCR-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|