C14H15BrCl2N2 — CID 79431748
5-[2-(3-bromophenyl)-3-chloropropyl]-4-chloro-1,3-dimethylpyrazole (PubChem CID 79431748) has the molecular formula C14H15BrCl2N2 and a molecular weight of 362.10 g/mol. Its IUPAC name is 5-[2-(3-bromophenyl)-3-chloropropyl]-4-chloro-1,3-dimethylpyrazole.
| Compound Name | 5-[2-(3-bromophenyl)-3-chloropropyl]-4-chloro-1,3-dimethylpyrazole |
|---|---|
| PubChem CID | 79431748 |
| Molecular Formula | C14H15BrCl2N2 |
| Molecular Weight | 362.10 g/mol |
| Exact Mass | 359.98 |
| IUPAC Name | 5-[2-(3-bromophenyl)-3-chloropropyl]-4-chloro-1,3-dimethylpyrazole |
| SMILES | Cc1nn(C)c(CC(CCl)c2cccc(Br)c2)c1Cl |
| InChI | InChI=1S/C14H15BrCl2N2/c1-9-14(17)13(19(2)18-9)7-11(8-16)10-4-3-5-12(15)6-10/h3-6,11H,7-8H2,1-2H3 |
| InChIKey | XIFCZABQNOEWOK-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.10 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|