About 3'-(4-methylphenyl)spiro[1,3-dihydroindene-2,4'-piperidine]
3'-(4-methylphenyl)spiro[1,3-dihydroindene-2,4'-piperidine] (PubChem CID 79432560) has the molecular formula C20H23N
and a molecular weight of 277.41 g/mol. Its IUPAC name is 3'-(4-methylphenyl)spiro[1,3-dihydroindene-2,4'-piperidine].
Molecular Properties
| Compound Name | 3'-(4-methylphenyl)spiro[1,3-dihydroindene-2,4'-piperidine] |
| PubChem CID | 79432560 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 3'-(4-methylphenyl)spiro[1,3-dihydroindene-2,4'-piperidine] |
| SMILES | Cc1ccc(C2CNCCC23Cc2ccccc2C3)cc1 |
| InChI | InChI=1S/C20H23N/c1-15-6-8-16(9-7-15)19-14-21-11-10-20(19)12-17-4-2-3-5-18(17)13-20/h2-9,19,21H,10-14H2,1H3 |
| InChIKey | ZFJDWTBKSQKSRX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3'-(4-methylphenyl)spiro[1,3-dihydroindene-2,4'-piperidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3'-(4-methylphenyl)spiro[1,3-dihydroindene-2,4'-piperidine]?
The IUPAC name of 3'-(4-methylphenyl)spiro[1,3-dihydroindene-2,4'-piperidine] (CID 79432560) is 3'-(4-methylphenyl)spiro[1,3-dihydroindene-2,4'-piperidine].
What is the SMILES notation for 3'-(4-methylphenyl)spiro[1,3-dihydroindene-2,4'-piperidine]?
The canonical SMILES for 3'-(4-methylphenyl)spiro[1,3-dihydroindene-2,4'-piperidine] is Cc1ccc(C2CNCCC23Cc2ccccc2C3)cc1.
What is the InChIKey of 3'-(4-methylphenyl)spiro[1,3-dihydroindene-2,4'-piperidine]?
The InChIKey is ZFJDWTBKSQKSRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N/c1-15-6-8-16(9-7-15)19-14-21-11-10-20(19)12-17-4-2-3-5-18(17)13-20/h2-9,19,21H,10-14H2,1H3.
What are the key properties of 3'-(4-methylphenyl)spiro[1,3-dihydroindene-2,4'-piperidine]?
3'-(4-methylphenyl)spiro[1,3-dihydroindene-2,4'-piperidine] has a molecular weight of 277.41 g/mol, XLogP of 3.86, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3'-(4-methylphenyl)spiro[1,3-dihydroindene-2,4'-piperidine] is sourced from PubChem (CID 79432560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).