C15H16FN3O2 — CID 79432801
2-(1-aminocyclopentyl)-5-(4-fluorophenyl)-4-hydroxy-1H-pyrimidin-6-one (PubChem CID 79432801) has the molecular formula C15H16FN3O2 and a molecular weight of 289.31 g/mol. Its IUPAC name is 2-(1-aminocyclopentyl)-5-(4-fluorophenyl)-4-hydroxy-1H-pyrimidin-6-one.
| Compound Name | 2-(1-aminocyclopentyl)-5-(4-fluorophenyl)-4-hydroxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 79432801 |
| Molecular Formula | C15H16FN3O2 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 2-(1-aminocyclopentyl)-5-(4-fluorophenyl)-4-hydroxy-1H-pyrimidin-6-one |
| SMILES | NC1(c2nc(O)c(-c3ccc(F)cc3)c(=O)[nH]2)CCCC1 |
| InChI | InChI=1S/C15H16FN3O2/c16-10-5-3-9(4-6-10)11-12(20)18-14(19-13(11)21)15(17)7-1-2-8-15/h3-6H,1-2,7-8,17H2,(H2,18,19,20,21) |
| InChIKey | UHTBTIYXKXHUSX-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |