About 5-(4-fluorophenyl)-9,9-dimethyl-3-azaspiro[5.6]dodecane
5-(4-fluorophenyl)-9,9-dimethyl-3-azaspiro[5.6]dodecane (PubChem CID 79432872) has the molecular formula C19H28FN
and a molecular weight of 289.44 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-9,9-dimethyl-3-azaspiro[5.6]dodecane.
Molecular Properties
| Compound Name | 5-(4-fluorophenyl)-9,9-dimethyl-3-azaspiro[5.6]dodecane |
| PubChem CID | 79432872 |
| Molecular Formula | C19H28FN |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | 5-(4-fluorophenyl)-9,9-dimethyl-3-azaspiro[5.6]dodecane |
| SMILES | CC1(C)CCCC2(CCNCC2c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H28FN/c1-18(2)8-3-9-19(11-10-18)12-13-21-14-17(19)15-4-6-16(20)7-5-15/h4-7,17,21H,3,8-14H2,1-2H3 |
| InChIKey | ONCCQGSLKRXWSG-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(4-fluorophenyl)-9,9-dimethyl-3-azaspiro[5.6]dodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-fluorophenyl)-9,9-dimethyl-3-azaspiro[5.6]dodecane?
The IUPAC name of 5-(4-fluorophenyl)-9,9-dimethyl-3-azaspiro[5.6]dodecane (CID 79432872) is 5-(4-fluorophenyl)-9,9-dimethyl-3-azaspiro[5.6]dodecane.
What is the SMILES notation for 5-(4-fluorophenyl)-9,9-dimethyl-3-azaspiro[5.6]dodecane?
The canonical SMILES for 5-(4-fluorophenyl)-9,9-dimethyl-3-azaspiro[5.6]dodecane is CC1(C)CCCC2(CCNCC2c2ccc(F)cc2)CC1.
What is the InChIKey of 5-(4-fluorophenyl)-9,9-dimethyl-3-azaspiro[5.6]dodecane?
The InChIKey is ONCCQGSLKRXWSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28FN/c1-18(2)8-3-9-19(11-10-18)12-13-21-14-17(19)15-4-6-16(20)7-5-15/h4-7,17,21H,3,8-14H2,1-2H3.
What are the key properties of 5-(4-fluorophenyl)-9,9-dimethyl-3-azaspiro[5.6]dodecane?
5-(4-fluorophenyl)-9,9-dimethyl-3-azaspiro[5.6]dodecane has a molecular weight of 289.44 g/mol, XLogP of 4.88, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-fluorophenyl)-9,9-dimethyl-3-azaspiro[5.6]dodecane is sourced from PubChem (CID 79432872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).