C12H16BrClO2S — CID 79433004
1-bromo-3-(1-chloro-4-ethylsulfonylbutan-2-yl)benzene (PubChem CID 79433004) has the molecular formula C12H16BrClO2S and a molecular weight of 339.68 g/mol. Its IUPAC name is 1-bromo-3-(1-chloro-4-ethylsulfonylbutan-2-yl)benzene.
| Compound Name | 1-bromo-3-(1-chloro-4-ethylsulfonylbutan-2-yl)benzene |
|---|---|
| PubChem CID | 79433004 |
| Molecular Formula | C12H16BrClO2S |
| Molecular Weight | 339.68 g/mol |
| Exact Mass | 337.97 |
| IUPAC Name | 1-bromo-3-(1-chloro-4-ethylsulfonylbutan-2-yl)benzene |
| SMILES | CCS(=O)(=O)CCC(CCl)c1cccc(Br)c1 |
| InChI | InChI=1S/C12H16BrClO2S/c1-2-17(15,16)7-6-11(9-14)10-4-3-5-12(13)8-10/h3-5,8,11H,2,6-7,9H2,1H3 |
| InChIKey | KDEAROOUVOJANH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.68 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|