About 3-(3-bromophenyl)-4,4-diethylpiperidine
3-(3-bromophenyl)-4,4-diethylpiperidine (PubChem CID 79433788) has the molecular formula C15H22BrN
and a molecular weight of 296.25 g/mol. Its IUPAC name is 3-(3-bromophenyl)-4,4-diethylpiperidine.
Molecular Properties
| Compound Name | 3-(3-bromophenyl)-4,4-diethylpiperidine |
| PubChem CID | 79433788 |
| Molecular Formula | C15H22BrN |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 3-(3-bromophenyl)-4,4-diethylpiperidine |
| SMILES | CCC1(CC)CCNCC1c1cccc(Br)c1 |
| InChI | InChI=1S/C15H22BrN/c1-3-15(4-2)8-9-17-11-14(15)12-6-5-7-13(16)10-12/h5-7,10,14,17H,3-4,8-9,11H2,1-2H3 |
| InChIKey | OJYIWDSZVDZGIW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(3-bromophenyl)-4,4-diethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-bromophenyl)-4,4-diethylpiperidine?
The IUPAC name of 3-(3-bromophenyl)-4,4-diethylpiperidine (CID 79433788) is 3-(3-bromophenyl)-4,4-diethylpiperidine.
What is the SMILES notation for 3-(3-bromophenyl)-4,4-diethylpiperidine?
The canonical SMILES for 3-(3-bromophenyl)-4,4-diethylpiperidine is CCC1(CC)CCNCC1c1cccc(Br)c1.
What is the InChIKey of 3-(3-bromophenyl)-4,4-diethylpiperidine?
The InChIKey is OJYIWDSZVDZGIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22BrN/c1-3-15(4-2)8-9-17-11-14(15)12-6-5-7-13(16)10-12/h5-7,10,14,17H,3-4,8-9,11H2,1-2H3.
What are the key properties of 3-(3-bromophenyl)-4,4-diethylpiperidine?
3-(3-bromophenyl)-4,4-diethylpiperidine has a molecular weight of 296.25 g/mol, XLogP of 4.33, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-bromophenyl)-4,4-diethylpiperidine is sourced from PubChem (CID 79433788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).