C17H18BrCl — CID 79434130
2-[2-(4-bromophenyl)-3-chloropropyl]-1,4-dimethylbenzene (PubChem CID 79434130) has the molecular formula C17H18BrCl and a molecular weight of 337.69 g/mol. Its IUPAC name is 2-[2-(4-bromophenyl)-3-chloropropyl]-1,4-dimethylbenzene.
| Compound Name | 2-[2-(4-bromophenyl)-3-chloropropyl]-1,4-dimethylbenzene |
|---|---|
| PubChem CID | 79434130 |
| Molecular Formula | C17H18BrCl |
| Molecular Weight | 337.69 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | 2-[2-(4-bromophenyl)-3-chloropropyl]-1,4-dimethylbenzene |
| SMILES | Cc1ccc(C)c(CC(CCl)c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C17H18BrCl/c1-12-3-4-13(2)15(9-12)10-16(11-19)14-5-7-17(18)8-6-14/h3-9,16H,10-11H2,1-2H3 |
| InChIKey | WICPJZLHCZPCHZ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.69 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|