C15H24FNO2S — CID 79437459
2-(4-fluorophenyl)-N-(2-methylpropyl)-4-methylsulfonylbutan-1-amine (PubChem CID 79437459) has the molecular formula C15H24FNO2S and a molecular weight of 301.43 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-(2-methylpropyl)-4-methylsulfonylbutan-1-amine.
| Compound Name | 2-(4-fluorophenyl)-N-(2-methylpropyl)-4-methylsulfonylbutan-1-amine |
|---|---|
| PubChem CID | 79437459 |
| Molecular Formula | C15H24FNO2S |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 2-(4-fluorophenyl)-N-(2-methylpropyl)-4-methylsulfonylbutan-1-amine |
| SMILES | CC(C)CNCC(CCS(C)(=O)=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H24FNO2S/c1-12(2)10-17-11-14(8-9-20(3,18)19)13-4-6-15(16)7-5-13/h4-7,12,14,17H,8-11H2,1-3H3 |
| InChIKey | SIGBTCHWLQSHGS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |