C13H17FO2 — CID 79438066
2-(4-fluorophenyl)-3-(oxolan-2-yl)propan-1-ol (PubChem CID 79438066) has the molecular formula C13H17FO2 and a molecular weight of 224.27 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-3-(oxolan-2-yl)propan-1-ol.
| Compound Name | 2-(4-fluorophenyl)-3-(oxolan-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 79438066 |
| Molecular Formula | C13H17FO2 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 2-(4-fluorophenyl)-3-(oxolan-2-yl)propan-1-ol |
| SMILES | OCC(CC1CCCO1)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H17FO2/c14-12-5-3-10(4-6-12)11(9-15)8-13-2-1-7-16-13/h3-6,11,13,15H,1-2,7-9H2 |
| InChIKey | GEGVFQCSRDJTOX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |